C10H8ClN5O4 — CID 103733138
2-chloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-5-nitropyridine-4-carboxamide (PubChem CID 103733138) has the molecular formula C10H8ClN5O4 and a molecular weight of 297.66 g/mol. Its IUPAC name is 2-chloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-5-nitropyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-5-nitropyridine-4-carboxamide |
|---|---|
| PubChem CID | 103733138 |
| Molecular Formula | C10H8ClN5O4 |
| Molecular Weight | 297.66 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 2-chloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-5-nitropyridine-4-carboxamide |
| SMILES | Cc1noc(CNC(=O)c2cc(Cl)ncc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C10H8ClN5O4/c1-5-14-9(20-15-5)4-13-10(17)6-2-8(11)12-3-7(6)16(18)19/h2-3H,4H2,1H3,(H,13,17) |
| InChIKey | XYASEBVVWWREAC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.66 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|