C9H10ClN3O4 — CID 103885996
2-chloro-N-[(2S)-2-hydroxypropyl]-5-nitropyridine-4-carboxamide (PubChem CID 103885996) has the molecular formula C9H10ClN3O4 and a molecular weight of 259.65 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-2-hydroxypropyl]-5-nitropyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[(2S)-2-hydroxypropyl]-5-nitropyridine-4-carboxamide |
|---|---|
| PubChem CID | 103885996 |
| Molecular Formula | C9H10ClN3O4 |
| Molecular Weight | 259.65 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 2-chloro-N-[(2S)-2-hydroxypropyl]-5-nitropyridine-4-carboxamide |
| SMILES | C[C@H](O)CNC(=O)c1cc(Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10ClN3O4/c1-5(14)3-12-9(15)6-2-8(10)11-4-7(6)13(16)17/h2,4-5,14H,3H2,1H3,(H,12,15)/t5-/m0/s1 |
| InChIKey | NRLWMYFYDGYNRD-YFKPBYRVSA-N |
| XLogP | 0.75 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.65 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|