C10H10ClN3O4 — CID 103881089
2-chloro-N-[1-(hydroxymethyl)cyclopropyl]-5-nitropyridine-4-carboxamide (PubChem CID 103881089) has the molecular formula C10H10ClN3O4 and a molecular weight of 271.66 g/mol. Its IUPAC name is 2-chloro-N-[1-(hydroxymethyl)cyclopropyl]-5-nitropyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[1-(hydroxymethyl)cyclopropyl]-5-nitropyridine-4-carboxamide |
|---|---|
| PubChem CID | 103881089 |
| Molecular Formula | C10H10ClN3O4 |
| Molecular Weight | 271.66 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 2-chloro-N-[1-(hydroxymethyl)cyclopropyl]-5-nitropyridine-4-carboxamide |
| SMILES | O=C(NC1(CO)CC1)c1cc(Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10ClN3O4/c11-8-3-6(7(4-12-8)14(17)18)9(16)13-10(5-15)1-2-10/h3-4,15H,1-2,5H2,(H,13,16) |
| InChIKey | DOGYUPCTEAWKHK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.66 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|