C11H12ClN3O3S — CID 113254749
2-chloro-5-nitro-N-(thiolan-2-ylmethyl)pyridine-4-carboxamide (PubChem CID 113254749) has the molecular formula C11H12ClN3O3S and a molecular weight of 301.75 g/mol. Its IUPAC name is 2-chloro-5-nitro-N-(thiolan-2-ylmethyl)pyridine-4-carboxamide.
| Compound Name | 2-chloro-5-nitro-N-(thiolan-2-ylmethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 113254749 |
| Molecular Formula | C11H12ClN3O3S |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 2-chloro-5-nitro-N-(thiolan-2-ylmethyl)pyridine-4-carboxamide |
| SMILES | O=C(NCC1CCCS1)c1cc(Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12ClN3O3S/c12-10-4-8(9(6-13-10)15(17)18)11(16)14-5-7-2-1-3-19-7/h4,6-7H,1-3,5H2,(H,14,16) |
| InChIKey | LTLYZXUBTUIQNP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|