C11H12ClN3O3S2 — CID 103747300
2-chloro-N-(1,4-dithian-2-ylmethyl)-5-nitropyridine-4-carboxamide (PubChem CID 103747300) has the molecular formula C11H12ClN3O3S2 and a molecular weight of 333.82 g/mol. Its IUPAC name is 2-chloro-N-(1,4-dithian-2-ylmethyl)-5-nitropyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(1,4-dithian-2-ylmethyl)-5-nitropyridine-4-carboxamide |
|---|---|
| PubChem CID | 103747300 |
| Molecular Formula | C11H12ClN3O3S2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 2-chloro-N-(1,4-dithian-2-ylmethyl)-5-nitropyridine-4-carboxamide |
| SMILES | O=C(NCC1CSCCS1)c1cc(Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12ClN3O3S2/c12-10-3-8(9(5-13-10)15(17)18)11(16)14-4-7-6-19-1-2-20-7/h3,5,7H,1-2,4,6H2,(H,14,16) |
| InChIKey | HTJYXWJIDFVZRB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|