C12H13ClN2O3S2 — CID 115686974
3-chloro-N-(1,4-dithian-2-ylmethyl)-2-nitrobenzamide (PubChem CID 115686974) has the molecular formula C12H13ClN2O3S2 and a molecular weight of 332.83 g/mol. Its IUPAC name is 3-chloro-N-(1,4-dithian-2-ylmethyl)-2-nitrobenzamide.
| Compound Name | 3-chloro-N-(1,4-dithian-2-ylmethyl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 115686974 |
| Molecular Formula | C12H13ClN2O3S2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 3-chloro-N-(1,4-dithian-2-ylmethyl)-2-nitrobenzamide |
| SMILES | O=C(NCC1CSCCS1)c1cccc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13ClN2O3S2/c13-10-3-1-2-9(11(10)15(17)18)12(16)14-6-8-7-19-4-5-20-8/h1-3,8H,4-7H2,(H,14,16) |
| InChIKey | QGHAJMYSIHHODC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|