C14H16N2OS2 — CID 115686996
N-(1,4-dithian-2-ylmethyl)-1H-indole-7-carboxamide (PubChem CID 115686996) has the molecular formula C14H16N2OS2 and a molecular weight of 292.43 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-1H-indole-7-carboxamide.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 115686996 |
| Molecular Formula | C14H16N2OS2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-1H-indole-7-carboxamide |
| SMILES | O=C(NCC1CSCCS1)c1cccc2cc[nH]c12 |
| InChI | InChI=1S/C14H16N2OS2/c17-14(16-8-11-9-18-6-7-19-11)12-3-1-2-10-4-5-15-13(10)12/h1-5,11,15H,6-9H2,(H,16,17) |
| InChIKey | FCMVAHXILADLDU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |