C16H17NO2S2 — CID 115687797
N-(1,4-dithian-2-ylmethyl)-1-hydroxynaphthalene-2-carboxamide (PubChem CID 115687797) has the molecular formula C16H17NO2S2 and a molecular weight of 319.45 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-1-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-1-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 115687797 |
| Molecular Formula | C16H17NO2S2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-1-hydroxynaphthalene-2-carboxamide |
| SMILES | O=C(NCC1CSCCS1)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C16H17NO2S2/c18-15-13-4-2-1-3-11(13)5-6-14(15)16(19)17-9-12-10-20-7-8-21-12/h1-6,12,18H,7-10H2,(H,17,19) |
| InChIKey | NLWZFLANOGXLBN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |