C15H17N3OS2 — CID 115752010
4-amino-N-(1,4-dithian-2-ylmethyl)quinoline-2-carboxamide (PubChem CID 115752010) has the molecular formula C15H17N3OS2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 4-amino-N-(1,4-dithian-2-ylmethyl)quinoline-2-carboxamide.
| Compound Name | 4-amino-N-(1,4-dithian-2-ylmethyl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 115752010 |
| Molecular Formula | C15H17N3OS2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 4-amino-N-(1,4-dithian-2-ylmethyl)quinoline-2-carboxamide |
| SMILES | Nc1cc(C(=O)NCC2CSCCS2)nc2ccccc12 |
| InChI | InChI=1S/C15H17N3OS2/c16-12-7-14(18-13-4-2-1-3-11(12)13)15(19)17-8-10-9-20-5-6-21-10/h1-4,7,10H,5-6,8-9H2,(H2,16,18)(H,17,19) |
| InChIKey | VETUQKOWRHITBQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |