C14H12N4OS — CID 63375458
4-amino-N-(1,3-thiazol-2-ylmethyl)quinoline-2-carboxamide (PubChem CID 63375458) has the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. Its IUPAC name is 4-amino-N-(1,3-thiazol-2-ylmethyl)quinoline-2-carboxamide.
| Compound Name | 4-amino-N-(1,3-thiazol-2-ylmethyl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 63375458 |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 4-amino-N-(1,3-thiazol-2-ylmethyl)quinoline-2-carboxamide |
| SMILES | Nc1cc(C(=O)NCc2nccs2)nc2ccccc12 |
| InChI | InChI=1S/C14H12N4OS/c15-10-7-12(18-11-4-2-1-3-9(10)11)14(19)17-8-13-16-5-6-20-13/h1-7H,8H2,(H2,15,18)(H,17,19) |
| InChIKey | UZMJYRIDCUKIIO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |