C16H15N3OS — CID 63375047
4-amino-N-[(5-methylthiophen-2-yl)methyl]quinoline-2-carboxamide (PubChem CID 63375047) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-amino-N-[(5-methylthiophen-2-yl)methyl]quinoline-2-carboxamide.
| Compound Name | 4-amino-N-[(5-methylthiophen-2-yl)methyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 63375047 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 4-amino-N-[(5-methylthiophen-2-yl)methyl]quinoline-2-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2cc(N)c3ccccc3n2)s1 |
| InChI | InChI=1S/C16H15N3OS/c1-10-6-7-11(21-10)9-18-16(20)15-8-13(17)12-4-2-3-5-14(12)19-15/h2-8H,9H2,1H3,(H2,17,19)(H,18,20) |
| InChIKey | XVWBBGNEESLKRD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |