C14H13N5OS — CID 62247287
2-hydrazinyl-N-(1,3-thiazol-2-ylmethyl)quinoline-4-carboxamide (PubChem CID 62247287) has the molecular formula C14H13N5OS and a molecular weight of 299.36 g/mol. Its IUPAC name is 2-hydrazinyl-N-(1,3-thiazol-2-ylmethyl)quinoline-4-carboxamide.
| Compound Name | 2-hydrazinyl-N-(1,3-thiazol-2-ylmethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 62247287 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-hydrazinyl-N-(1,3-thiazol-2-ylmethyl)quinoline-4-carboxamide |
| SMILES | NNc1cc(C(=O)NCc2nccs2)c2ccccc2n1 |
| InChI | InChI=1S/C14H13N5OS/c15-19-12-7-10(9-3-1-2-4-11(9)18-12)14(20)17-8-13-16-5-6-21-13/h1-7H,8,15H2,(H,17,20)(H,18,19) |
| InChIKey | OFNATVAWPBWOKZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|