C14H17N5O2 — CID 62241412
N-(2-acetamidoethyl)-2-hydrazinylquinoline-4-carboxamide (PubChem CID 62241412) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-hydrazinylquinoline-4-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-2-hydrazinylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 62241412 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N-(2-acetamidoethyl)-2-hydrazinylquinoline-4-carboxamide |
| SMILES | CC(=O)NCCNC(=O)c1cc(NN)nc2ccccc12 |
| InChI | InChI=1S/C14H17N5O2/c1-9(20)16-6-7-17-14(21)11-8-13(19-15)18-12-5-3-2-4-10(11)12/h2-5,8H,6-7,15H2,1H3,(H,16,20)(H,17,21)(H,18,19) |
| InChIKey | XRNZVLKHIOGSSL-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|