C15H20N4O — CID 62242819
N-ethyl-2-hydrazinyl-N-propylquinoline-4-carboxamide (PubChem CID 62242819) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is N-ethyl-2-hydrazinyl-N-propylquinoline-4-carboxamide.
| Compound Name | N-ethyl-2-hydrazinyl-N-propylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 62242819 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | N-ethyl-2-hydrazinyl-N-propylquinoline-4-carboxamide |
| SMILES | CCCN(CC)C(=O)c1cc(NN)nc2ccccc12 |
| InChI | InChI=1S/C15H20N4O/c1-3-9-19(4-2)15(20)12-10-14(18-16)17-13-8-6-5-7-11(12)13/h5-8,10H,3-4,9,16H2,1-2H3,(H,17,18) |
| InChIKey | UFMYTVKCUUJQEF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|