C12H14BrNOS2 — CID 115684611
2-bromo-N-(1,4-dithian-2-ylmethyl)benzamide (PubChem CID 115684611) has the molecular formula C12H14BrNOS2 and a molecular weight of 332.29 g/mol. Its IUPAC name is 2-bromo-N-(1,4-dithian-2-ylmethyl)benzamide.
| Compound Name | 2-bromo-N-(1,4-dithian-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 115684611 |
| Molecular Formula | C12H14BrNOS2 |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 330.97 |
| IUPAC Name | 2-bromo-N-(1,4-dithian-2-ylmethyl)benzamide |
| SMILES | O=C(NCC1CSCCS1)c1ccccc1Br |
| InChI | InChI=1S/C12H14BrNOS2/c13-11-4-2-1-3-10(11)12(15)14-7-9-8-16-5-6-17-9/h1-4,9H,5-8H2,(H,14,15) |
| InChIKey | GFCZKQNLXVMUSN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |