C13H18N2OS2 — CID 113489585
N-(1,4-dithian-2-ylmethyl)-4-(methylamino)benzamide (PubChem CID 113489585) has the molecular formula C13H18N2OS2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-4-(methylamino)benzamide.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-4-(methylamino)benzamide |
|---|---|
| PubChem CID | 113489585 |
| Molecular Formula | C13H18N2OS2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-4-(methylamino)benzamide |
| SMILES | CNc1ccc(C(=O)NCC2CSCCS2)cc1 |
| InChI | InChI=1S/C13H18N2OS2/c1-14-11-4-2-10(3-5-11)13(16)15-8-12-9-17-6-7-18-12/h2-5,12,14H,6-9H2,1H3,(H,15,16) |
| InChIKey | PPDORSAYNWHQRM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |