C15H19NO3S2 — CID 103429338
2-(1,4-dithian-2-ylmethylcarbamoyl)-3,6-dimethylbenzoic acid (PubChem CID 103429338) has the molecular formula C15H19NO3S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is 2-(1,4-dithian-2-ylmethylcarbamoyl)-3,6-dimethylbenzoic acid.
| Compound Name | 2-(1,4-dithian-2-ylmethylcarbamoyl)-3,6-dimethylbenzoic acid |
|---|---|
| PubChem CID | 103429338 |
| Molecular Formula | C15H19NO3S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 2-(1,4-dithian-2-ylmethylcarbamoyl)-3,6-dimethylbenzoic acid |
| SMILES | Cc1ccc(C)c(C(=O)NCC2CSCCS2)c1C(=O)O |
| InChI | InChI=1S/C15H19NO3S2/c1-9-3-4-10(2)13(15(18)19)12(9)14(17)16-7-11-8-20-5-6-21-11/h3-4,11H,5-8H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | XZXJUCTVPDXOHN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |