C13H19ClN2OS2 — CID 119788268
2-anilino-N-(1,4-dithian-2-ylmethyl)acetamide;hydrochloride (PubChem CID 119788268) has the molecular formula C13H19ClN2OS2 and a molecular weight of 318.89 g/mol. Its IUPAC name is 2-anilino-N-(1,4-dithian-2-ylmethyl)acetamide;hydrochloride.
| Compound Name | 2-anilino-N-(1,4-dithian-2-ylmethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119788268 |
| Molecular Formula | C13H19ClN2OS2 |
| Molecular Weight | 318.89 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 2-anilino-N-(1,4-dithian-2-ylmethyl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CNc1ccccc1)NCC1CSCCS1 |
| InChI | InChI=1S/C13H18N2OS2.ClH/c16-13(9-14-11-4-2-1-3-5-11)15-8-12-10-17-6-7-18-12;/h1-5,12,14H,6-10H2,(H,15,16);1H |
| InChIKey | SLJQCYBITKVNGG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.89 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |