C11H22N2OS2 — CID 115739503
4-amino-N-(1,4-dithian-2-ylmethyl)-4-methylpentanamide (PubChem CID 115739503) has the molecular formula C11H22N2OS2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 4-amino-N-(1,4-dithian-2-ylmethyl)-4-methylpentanamide.
| Compound Name | 4-amino-N-(1,4-dithian-2-ylmethyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 115739503 |
| Molecular Formula | C11H22N2OS2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 4-amino-N-(1,4-dithian-2-ylmethyl)-4-methylpentanamide |
| SMILES | CC(C)(N)CCC(=O)NCC1CSCCS1 |
| InChI | InChI=1S/C11H22N2OS2/c1-11(2,12)4-3-10(14)13-7-9-8-15-5-6-16-9/h9H,3-8,12H2,1-2H3,(H,13,14) |
| InChIKey | VCSHXXGNEYNNHO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |