C10H18N2OS2 — CID 103797025
(2R)-N-(1,4-dithian-2-ylmethyl)pyrrolidine-2-carboxamide (PubChem CID 103797025) has the molecular formula C10H18N2OS2 and a molecular weight of 246.40 g/mol. Its IUPAC name is (2R)-N-(1,4-dithian-2-ylmethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(1,4-dithian-2-ylmethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 103797025 |
| Molecular Formula | C10H18N2OS2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (2R)-N-(1,4-dithian-2-ylmethyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCC1CSCCS1)[C@H]1CCCN1 |
| InChI | InChI=1S/C10H18N2OS2/c13-10(9-2-1-3-11-9)12-6-8-7-14-4-5-15-8/h8-9,11H,1-7H2,(H,12,13)/t8?,9-/m1/s1 |
| InChIKey | PRAVFMHKQYLLDA-YGPZHTELSA-N |
| XLogP | 0.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |