C12H22N2OS2 — CID 113489395
N-(1,4-dithian-2-ylmethyl)azepane-2-carboxamide (PubChem CID 113489395) has the molecular formula C12H22N2OS2 and a molecular weight of 274.45 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)azepane-2-carboxamide.
| Compound Name | N-(1,4-dithian-2-ylmethyl)azepane-2-carboxamide |
|---|---|
| PubChem CID | 113489395 |
| Molecular Formula | C12H22N2OS2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)azepane-2-carboxamide |
| SMILES | O=C(NCC1CSCCS1)C1CCCCCN1 |
| InChI | InChI=1S/C12H22N2OS2/c15-12(11-4-2-1-3-5-13-11)14-8-10-9-16-6-7-17-10/h10-11,13H,1-9H2,(H,14,15) |
| InChIKey | LLKGJLBMWNCWQX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |