C12H22N2OS2 — CID 95975061
1-cyclohexyl-3-[[(2R)-1,4-dithian-2-yl]methyl]urea (PubChem CID 95975061) has the molecular formula C12H22N2OS2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 1-cyclohexyl-3-[[(2R)-1,4-dithian-2-yl]methyl]urea.
| Compound Name | 1-cyclohexyl-3-[[(2R)-1,4-dithian-2-yl]methyl]urea |
|---|---|
| PubChem CID | 95975061 |
| Molecular Formula | C12H22N2OS2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 1-cyclohexyl-3-[[(2R)-1,4-dithian-2-yl]methyl]urea |
| SMILES | O=C(NC[C@@H]1CSCCS1)NC1CCCCC1 |
| InChI | InChI=1S/C12H22N2OS2/c15-12(14-10-4-2-1-3-5-10)13-8-11-9-16-6-7-17-11/h10-11H,1-9H2,(H2,13,14,15)/t11-/m1/s1 |
| InChIKey | OEZQGVRMRNEFFV-LLVKDONJSA-N |
| XLogP | 2.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |