C11H21N3S2 — CID 115684905
1-cyclopentyl-2-(1,4-dithian-2-ylmethyl)guanidine (PubChem CID 115684905) has the molecular formula C11H21N3S2 and a molecular weight of 259.44 g/mol. Its IUPAC name is 1-cyclopentyl-2-(1,4-dithian-2-ylmethyl)guanidine.
| Compound Name | 1-cyclopentyl-2-(1,4-dithian-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 115684905 |
| Molecular Formula | C11H21N3S2 |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-cyclopentyl-2-(1,4-dithian-2-ylmethyl)guanidine |
| SMILES | N/C(=N\CC1CSCCS1)NC1CCCC1 |
| InChI | InChI=1S/C11H21N3S2/c12-11(14-9-3-1-2-4-9)13-7-10-8-15-5-6-16-10/h9-10H,1-8H2,(H3,12,13,14) |
| InChIKey | OFUIXSFEJYQGPU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|