About (2R)-2-amino-N-(1,4-dithian-2-ylmethyl)propanamide;hydrochloride
(2R)-2-amino-N-(1,4-dithian-2-ylmethyl)propanamide;hydrochloride (PubChem CID 119326363) has the molecular formula C8H17ClN2OS2
and a molecular weight of 256.82 g/mol. Its IUPAC name is (2R)-2-amino-N-(1,4-dithian-2-ylmethyl)propanamide;hydrochloride.
Molecular Properties
| Compound Name | (2R)-2-amino-N-(1,4-dithian-2-ylmethyl)propanamide;hydrochloride |
| PubChem CID | 119326363 |
| Molecular Formula | C8H17ClN2OS2 |
| Molecular Weight | 256.82 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | (2R)-2-amino-N-(1,4-dithian-2-ylmethyl)propanamide;hydrochloride |
| SMILES | C[C@@H](N)C(=O)NCC1CSCCS1.Cl |
| InChI | InChI=1S/C8H16N2OS2.ClH/c1-6(9)8(11)10-4-7-5-12-2-3-13-7;/h6-7H,2-5,9H2,1H3,(H,10,11);1H/t6-,7?;/m1./s1 |
| InChIKey | LLXHNXADANLMOS-JVEOKNEYSA-N |
| XLogP | 0.72 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.82 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-amino-N-(1,4-dithian-2-ylmethyl)propanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-N-(1,4-dithian-2-ylmethyl)propanamide;hydrochloride?
The IUPAC name of (2R)-2-amino-N-(1,4-dithian-2-ylmethyl)propanamide;hydrochloride (CID 119326363) is (2R)-2-amino-N-(1,4-dithian-2-ylmethyl)propanamide;hydrochloride.
What is the SMILES notation for (2R)-2-amino-N-(1,4-dithian-2-ylmethyl)propanamide;hydrochloride?
The canonical SMILES for (2R)-2-amino-N-(1,4-dithian-2-ylmethyl)propanamide;hydrochloride is C[C@@H](N)C(=O)NCC1CSCCS1.Cl.
What is the InChIKey of (2R)-2-amino-N-(1,4-dithian-2-ylmethyl)propanamide;hydrochloride?
The InChIKey is LLXHNXADANLMOS-JVEOKNEYSA-N. The full InChI is InChI=1S/C8H16N2OS2.ClH/c1-6(9)8(11)10-4-7-5-12-2-3-13-7;/h6-7H,2-5,9H2,1H3,(H,10,11);1H/t6-,7?;/m1./s1.
What are the key properties of (2R)-2-amino-N-(1,4-dithian-2-ylmethyl)propanamide;hydrochloride?
(2R)-2-amino-N-(1,4-dithian-2-ylmethyl)propanamide;hydrochloride has a molecular weight of 256.82 g/mol, XLogP of 0.72, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-N-(1,4-dithian-2-ylmethyl)propanamide;hydrochloride is sourced from PubChem (CID 119326363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).