C16H21N3OS2 — CID 119957436
(2S)-2-amino-N-(1,4-dithian-2-ylmethyl)-3-(1H-indol-3-yl)propanamide (PubChem CID 119957436) has the molecular formula C16H21N3OS2 and a molecular weight of 335.50 g/mol. Its IUPAC name is (2S)-2-amino-N-(1,4-dithian-2-ylmethyl)-3-(1H-indol-3-yl)propanamide.
| Compound Name | (2S)-2-amino-N-(1,4-dithian-2-ylmethyl)-3-(1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 119957436 |
| Molecular Formula | C16H21N3OS2 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | (2S)-2-amino-N-(1,4-dithian-2-ylmethyl)-3-(1H-indol-3-yl)propanamide |
| SMILES | N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCC1CSCCS1 |
| InChI | InChI=1S/C16H21N3OS2/c17-14(16(20)19-9-12-10-21-5-6-22-12)7-11-8-18-15-4-2-1-3-13(11)15/h1-4,8,12,14,18H,5-7,9-10,17H2,(H,19,20)/t12?,14-/m0/s1 |
| InChIKey | NVNCXBDLOCXINC-PYMCNQPYSA-N |
| XLogP | 2.00 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |