C14H20N2OS2 — CID 103797022
(2S)-2-amino-N-(1,4-dithian-2-ylmethyl)-3-phenylpropanamide (PubChem CID 103797022) has the molecular formula C14H20N2OS2 and a molecular weight of 296.46 g/mol. Its IUPAC name is (2S)-2-amino-N-(1,4-dithian-2-ylmethyl)-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-(1,4-dithian-2-ylmethyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 103797022 |
| Molecular Formula | C14H20N2OS2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (2S)-2-amino-N-(1,4-dithian-2-ylmethyl)-3-phenylpropanamide |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)NCC1CSCCS1 |
| InChI | InChI=1S/C14H20N2OS2/c15-13(8-11-4-2-1-3-5-11)14(17)16-9-12-10-18-6-7-19-12/h1-5,12-13H,6-10,15H2,(H,16,17)/t12?,13-/m0/s1 |
| InChIKey | VUOBSTCDEGKXKM-ABLWVSNPSA-N |
| XLogP | 1.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |