C9H18N2OS2 — CID 104866324
(2R)-2-amino-N-(1,4-dithian-2-ylmethyl)butanamide (PubChem CID 104866324) has the molecular formula C9H18N2OS2 and a molecular weight of 234.39 g/mol. Its IUPAC name is (2R)-2-amino-N-(1,4-dithian-2-ylmethyl)butanamide.
| Compound Name | (2R)-2-amino-N-(1,4-dithian-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 104866324 |
| Molecular Formula | C9H18N2OS2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (2R)-2-amino-N-(1,4-dithian-2-ylmethyl)butanamide |
| SMILES | CC[C@@H](N)C(=O)NCC1CSCCS1 |
| InChI | InChI=1S/C9H18N2OS2/c1-2-8(10)9(12)11-5-7-6-13-3-4-14-7/h7-8H,2-6,10H2,1H3,(H,11,12)/t7?,8-/m1/s1 |
| InChIKey | UAAXVFCKYJGEKZ-BRFYHDHCSA-N |
| XLogP | 0.69 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |