C11H22N2OS2 — CID 103833140
(2S)-2-amino-N-(1,4-dithian-2-ylmethyl)-3-methylpentanamide (PubChem CID 103833140) has the molecular formula C11H22N2OS2 and a molecular weight of 262.44 g/mol. Its IUPAC name is (2S)-2-amino-N-(1,4-dithian-2-ylmethyl)-3-methylpentanamide.
| Compound Name | (2S)-2-amino-N-(1,4-dithian-2-ylmethyl)-3-methylpentanamide |
|---|---|
| PubChem CID | 103833140 |
| Molecular Formula | C11H22N2OS2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (2S)-2-amino-N-(1,4-dithian-2-ylmethyl)-3-methylpentanamide |
| SMILES | CCC(C)[C@H](N)C(=O)NCC1CSCCS1 |
| InChI | InChI=1S/C11H22N2OS2/c1-3-8(2)10(12)11(14)13-6-9-7-15-4-5-16-9/h8-10H,3-7,12H2,1-2H3,(H,13,14)/t8?,9?,10-/m0/s1 |
| InChIKey | WFPMGRAQQCKSAG-RTBKNWGFSA-N |
| XLogP | 1.32 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |