C12H21NO3S2 — CID 116537513
2-(1,4-dithian-2-ylmethylcarbamoyl)-3,3-dimethylbutanoic acid (PubChem CID 116537513) has the molecular formula C12H21NO3S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-(1,4-dithian-2-ylmethylcarbamoyl)-3,3-dimethylbutanoic acid.
| Compound Name | 2-(1,4-dithian-2-ylmethylcarbamoyl)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 116537513 |
| Molecular Formula | C12H21NO3S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-(1,4-dithian-2-ylmethylcarbamoyl)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)C(=O)NCC1CSCCS1 |
| InChI | InChI=1S/C12H21NO3S2/c1-12(2,3)9(11(15)16)10(14)13-6-8-7-17-4-5-18-8/h8-9H,4-7H2,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | WPGKPPHRCYDCDF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|