C10H12ClF3N2O — CID 119726408
2-anilino-N-(2,2,2-trifluoroethyl)acetamide;hydrochloride (PubChem CID 119726408) has the molecular formula C10H12ClF3N2O and a molecular weight of 268.67 g/mol. Its IUPAC name is 2-anilino-N-(2,2,2-trifluoroethyl)acetamide;hydrochloride.
| Compound Name | 2-anilino-N-(2,2,2-trifluoroethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119726408 |
| Molecular Formula | C10H12ClF3N2O |
| Molecular Weight | 268.67 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-anilino-N-(2,2,2-trifluoroethyl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CNc1ccccc1)NCC(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O.ClH/c11-10(12,13)7-15-9(16)6-14-8-4-2-1-3-5-8;/h1-5,14H,6-7H2,(H,15,16);1H |
| InChIKey | WMNIKSCSUADNGO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.67 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |