C15H24N2O2 — CID 106148276
2-anilino-N-(5-hydroxy-2,2-dimethylpentyl)acetamide (PubChem CID 106148276) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-anilino-N-(5-hydroxy-2,2-dimethylpentyl)acetamide.
| Compound Name | 2-anilino-N-(5-hydroxy-2,2-dimethylpentyl)acetamide |
|---|---|
| PubChem CID | 106148276 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 2-anilino-N-(5-hydroxy-2,2-dimethylpentyl)acetamide |
| SMILES | CC(C)(CCCO)CNC(=O)CNc1ccccc1 |
| InChI | InChI=1S/C15H24N2O2/c1-15(2,9-6-10-18)12-17-14(19)11-16-13-7-4-3-5-8-13/h3-5,7-8,16,18H,6,9-12H2,1-2H3,(H,17,19) |
| InChIKey | QPSJMXKROXOBCW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |