C17H28N2O2 — CID 106148257
4-amino-N-(5-hydroxy-2,2-dimethylpentyl)-4-phenylbutanamide (PubChem CID 106148257) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 4-amino-N-(5-hydroxy-2,2-dimethylpentyl)-4-phenylbutanamide.
| Compound Name | 4-amino-N-(5-hydroxy-2,2-dimethylpentyl)-4-phenylbutanamide |
|---|---|
| PubChem CID | 106148257 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 4-amino-N-(5-hydroxy-2,2-dimethylpentyl)-4-phenylbutanamide |
| SMILES | CC(C)(CCCO)CNC(=O)CCC(N)c1ccccc1 |
| InChI | InChI=1S/C17H28N2O2/c1-17(2,11-6-12-20)13-19-16(21)10-9-15(18)14-7-4-3-5-8-14/h3-5,7-8,15,20H,6,9-13,18H2,1-2H3,(H,19,21) |
| InChIKey | MSYWXJPESHXNGS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |