C15H23NO2S — CID 106149651
N-(5-hydroxy-2,2-dimethylpentyl)-2-(4-sulfanylphenyl)acetamide (PubChem CID 106149651) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is N-(5-hydroxy-2,2-dimethylpentyl)-2-(4-sulfanylphenyl)acetamide.
| Compound Name | N-(5-hydroxy-2,2-dimethylpentyl)-2-(4-sulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 106149651 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-(5-hydroxy-2,2-dimethylpentyl)-2-(4-sulfanylphenyl)acetamide |
| SMILES | CC(C)(CCCO)CNC(=O)Cc1ccc(S)cc1 |
| InChI | InChI=1S/C15H23NO2S/c1-15(2,8-3-9-17)11-16-14(18)10-12-4-6-13(19)7-5-12/h4-7,17,19H,3,8-11H2,1-2H3,(H,16,18) |
| InChIKey | OTXMBCWHTFEKLV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|