C12H26N2O2 — CID 106148146
3-amino-N-(5-hydroxy-2,2-dimethylpentyl)-3-methylbutanamide (PubChem CID 106148146) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-amino-N-(5-hydroxy-2,2-dimethylpentyl)-3-methylbutanamide.
| Compound Name | 3-amino-N-(5-hydroxy-2,2-dimethylpentyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 106148146 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 3-amino-N-(5-hydroxy-2,2-dimethylpentyl)-3-methylbutanamide |
| SMILES | CC(C)(N)CC(=O)NCC(C)(C)CCCO |
| InChI | InChI=1S/C12H26N2O2/c1-11(2,6-5-7-15)9-14-10(16)8-12(3,4)13/h15H,5-9,13H2,1-4H3,(H,14,16) |
| InChIKey | GUIUYWIGYMLBAD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |