C12H26N2O — CID 115155111
3-amino-N-(2,2-dimethylpentyl)-3-methylbutanamide (PubChem CID 115155111) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is 3-amino-N-(2,2-dimethylpentyl)-3-methylbutanamide.
| Compound Name | 3-amino-N-(2,2-dimethylpentyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 115155111 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 3-amino-N-(2,2-dimethylpentyl)-3-methylbutanamide |
| SMILES | CCCC(C)(C)CNC(=O)CC(C)(C)N |
| InChI | InChI=1S/C12H26N2O/c1-6-7-11(2,3)9-14-10(15)8-12(4,5)13/h6-9,13H2,1-5H3,(H,14,15) |
| InChIKey | NEOGOPDIEOZEEJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |