C13H18N2O2S2 — CID 95975277
1-[[(2S)-1,4-dithian-2-yl]methyl]-3-(2-methoxyphenyl)urea (PubChem CID 95975277) has the molecular formula C13H18N2O2S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-[[(2S)-1,4-dithian-2-yl]methyl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[[(2S)-1,4-dithian-2-yl]methyl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 95975277 |
| Molecular Formula | C13H18N2O2S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1-[[(2S)-1,4-dithian-2-yl]methyl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)NC[C@H]1CSCCS1 |
| InChI | InChI=1S/C13H18N2O2S2/c1-17-12-5-3-2-4-11(12)15-13(16)14-8-10-9-18-6-7-19-10/h2-5,10H,6-9H2,1H3,(H2,14,15,16)/t10-/m0/s1 |
| InChIKey | DNHJJTILMBRVOF-JTQLQIEISA-N |
| XLogP | 2.67 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |