C14H16N2O2S2 — CID 115684629
2-(2-cyanophenoxy)-N-(1,4-dithian-2-ylmethyl)acetamide (PubChem CID 115684629) has the molecular formula C14H16N2O2S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-(1,4-dithian-2-ylmethyl)acetamide.
| Compound Name | 2-(2-cyanophenoxy)-N-(1,4-dithian-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 115684629 |
| Molecular Formula | C14H16N2O2S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-(1,4-dithian-2-ylmethyl)acetamide |
| SMILES | N#Cc1ccccc1OCC(=O)NCC1CSCCS1 |
| InChI | InChI=1S/C14H16N2O2S2/c15-7-11-3-1-2-4-13(11)18-9-14(17)16-8-12-10-19-5-6-20-12/h1-4,12H,5-6,8-10H2,(H,16,17) |
| InChIKey | YZPBCBVNZGBGRY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |