C11H13ClN2OS2 — CID 115687003
2-chloro-N-(1,4-dithian-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 115687003) has the molecular formula C11H13ClN2OS2 and a molecular weight of 288.82 g/mol. Its IUPAC name is 2-chloro-N-(1,4-dithian-2-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(1,4-dithian-2-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 115687003 |
| Molecular Formula | C11H13ClN2OS2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 2-chloro-N-(1,4-dithian-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCC1CSCCS1)c1cccnc1Cl |
| InChI | InChI=1S/C11H13ClN2OS2/c12-10-9(2-1-3-13-10)11(15)14-6-8-7-16-4-5-17-8/h1-3,8H,4-7H2,(H,14,15) |
| InChIKey | GHKRMNLXQGMOIU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|