C12H13ClFNOS2 — CID 115684594
5-chloro-N-(1,4-dithian-2-ylmethyl)-2-fluorobenzamide (PubChem CID 115684594) has the molecular formula C12H13ClFNOS2 and a molecular weight of 305.83 g/mol. Its IUPAC name is 5-chloro-N-(1,4-dithian-2-ylmethyl)-2-fluorobenzamide.
| Compound Name | 5-chloro-N-(1,4-dithian-2-ylmethyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 115684594 |
| Molecular Formula | C12H13ClFNOS2 |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 5-chloro-N-(1,4-dithian-2-ylmethyl)-2-fluorobenzamide |
| SMILES | O=C(NCC1CSCCS1)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C12H13ClFNOS2/c13-8-1-2-11(14)10(5-8)12(16)15-6-9-7-17-3-4-18-9/h1-2,5,9H,3-4,6-7H2,(H,15,16) |
| InChIKey | MPMUQIGRVYSHLZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |