C13H15ClFNOS — CID 80599963
5-chloro-2-fluoro-N-(thian-2-ylmethyl)benzamide (PubChem CID 80599963) has the molecular formula C13H15ClFNOS and a molecular weight of 287.79 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-(thian-2-ylmethyl)benzamide.
| Compound Name | 5-chloro-2-fluoro-N-(thian-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 80599963 |
| Molecular Formula | C13H15ClFNOS |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 5-chloro-2-fluoro-N-(thian-2-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCCCS1)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C13H15ClFNOS/c14-9-4-5-12(15)11(7-9)13(17)16-8-10-3-1-2-6-18-10/h4-5,7,10H,1-3,6,8H2,(H,16,17) |
| InChIKey | VCUMUBLKAUVILV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |