C13H16BrNOS2 — CID 107032840
2-bromo-5-sulfanyl-N-(thian-2-ylmethyl)benzamide (PubChem CID 107032840) has the molecular formula C13H16BrNOS2 and a molecular weight of 346.32 g/mol. Its IUPAC name is 2-bromo-5-sulfanyl-N-(thian-2-ylmethyl)benzamide.
| Compound Name | 2-bromo-5-sulfanyl-N-(thian-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 107032840 |
| Molecular Formula | C13H16BrNOS2 |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | 2-bromo-5-sulfanyl-N-(thian-2-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCCCS1)c1cc(S)ccc1Br |
| InChI | InChI=1S/C13H16BrNOS2/c14-12-5-4-9(17)7-11(12)13(16)15-8-10-3-1-2-6-18-10/h4-5,7,10,17H,1-3,6,8H2,(H,15,16) |
| InChIKey | SOTVJGKOKWHMBB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|