C12H14FNO2S2 — CID 113355825
N-(1,4-dithian-2-ylmethyl)-2-fluoro-4-hydroxybenzamide (PubChem CID 113355825) has the molecular formula C12H14FNO2S2 and a molecular weight of 287.38 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-2-fluoro-4-hydroxybenzamide.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-2-fluoro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 113355825 |
| Molecular Formula | C12H14FNO2S2 |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-2-fluoro-4-hydroxybenzamide |
| SMILES | O=C(NCC1CSCCS1)c1ccc(O)cc1F |
| InChI | InChI=1S/C12H14FNO2S2/c13-11-5-8(15)1-2-10(11)12(16)14-6-9-7-17-3-4-18-9/h1-2,5,9,15H,3-4,6-7H2,(H,14,16) |
| InChIKey | PUHZJLHJCRQDQF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |