4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid

C13H17NO2S2 — CID 113489433

IUPAC4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid
SMILESCc1cc(NCC2CSCCS2)ccc1C(=O)O
InChIInChI=1S/C13H17NO2S2/c1-9-6-10(2-3-12(9)13(15)16)14-7-11-8-17-4-5-18-11/h2-3,6,11,14H,4-5,7-8H2,1H3,(H,15,16)
InChIKeyIMPHYDGECBVWSU-UHFFFAOYSA-N
MW283.42 g/mol
LogP2.95
Rot. Bonds4

About 4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid

4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid (PubChem CID 113489433) has the molecular formula C13H17NO2S2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid.

Molecular Properties

Compound Name4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid
PubChem CID113489433
Molecular FormulaC13H17NO2S2
Molecular Weight283.42 g/mol
Exact Mass283.07
IUPAC Name4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid
SMILESCc1cc(NCC2CSCCS2)ccc1C(=O)O
InChIInChI=1S/C13H17NO2S2/c1-9-6-10(2-3-12(9)13(15)16)14-7-11-8-17-4-5-18-11/h2-3,6,11,14H,4-5,7-8H2,1H3,(H,15,16)
InChIKeyIMPHYDGECBVWSU-UHFFFAOYSA-N
XLogP2.95
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.42
LogP ≤ 52.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid?
The IUPAC name of 4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid (CID 113489433) is 4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid.
What is the SMILES notation for 4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid?
The canonical SMILES for 4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid is Cc1cc(NCC2CSCCS2)ccc1C(=O)O.
What is the InChIKey of 4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid?
The InChIKey is IMPHYDGECBVWSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2S2/c1-9-6-10(2-3-12(9)13(15)16)14-7-11-8-17-4-5-18-11/h2-3,6,11,14H,4-5,7-8H2,1H3,(H,15,16).
What are the key properties of 4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid?
4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid has a molecular weight of 283.42 g/mol, XLogP of 2.95, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid is sourced from PubChem (CID 113489433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).