C13H17NO2S2 — CID 113489433
4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid (PubChem CID 113489433) has the molecular formula C13H17NO2S2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid.
| Compound Name | 4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 113489433 |
| Molecular Formula | C13H17NO2S2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 4-(1,4-dithian-2-ylmethylamino)-2-methylbenzoic acid |
| SMILES | Cc1cc(NCC2CSCCS2)ccc1C(=O)O |
| InChI | InChI=1S/C13H17NO2S2/c1-9-6-10(2-3-12(9)13(15)16)14-7-11-8-17-4-5-18-11/h2-3,6,11,14H,4-5,7-8H2,1H3,(H,15,16) |
| InChIKey | IMPHYDGECBVWSU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |