C10H13ClN2S2 — CID 103757201
2-chloro-N-(1,4-dithian-2-ylmethyl)pyridin-4-amine (PubChem CID 103757201) has the molecular formula C10H13ClN2S2 and a molecular weight of 260.81 g/mol. Its IUPAC name is 2-chloro-N-(1,4-dithian-2-ylmethyl)pyridin-4-amine.
| Compound Name | 2-chloro-N-(1,4-dithian-2-ylmethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 103757201 |
| Molecular Formula | C10H13ClN2S2 |
| Molecular Weight | 260.81 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 2-chloro-N-(1,4-dithian-2-ylmethyl)pyridin-4-amine |
| SMILES | Clc1cc(NCC2CSCCS2)ccn1 |
| InChI | InChI=1S/C10H13ClN2S2/c11-10-5-8(1-2-12-10)13-6-9-7-14-3-4-15-9/h1-2,5,9H,3-4,6-7H2,(H,12,13) |
| InChIKey | UJYAVBVHKMZTKN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.81 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|