C10H15N3S2 — CID 115689494
N-(1,4-dithian-2-ylmethyl)-6-methylpyrimidin-4-amine (PubChem CID 115689494) has the molecular formula C10H15N3S2 and a molecular weight of 241.38 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-6-methylpyrimidin-4-amine.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 115689494 |
| Molecular Formula | C10H15N3S2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(NCC2CSCCS2)ncn1 |
| InChI | InChI=1S/C10H15N3S2/c1-8-4-10(13-7-12-8)11-5-9-6-14-2-3-15-9/h4,7,9H,2-3,5-6H2,1H3,(H,11,12,13) |
| InChIKey | PYXGTWLJJHJIMU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |