C10H14N2S2 — CID 115685335
N-(1,4-dithian-2-ylmethyl)pyridin-2-amine (PubChem CID 115685335) has the molecular formula C10H14N2S2 and a molecular weight of 226.37 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)pyridin-2-amine.
| Compound Name | N-(1,4-dithian-2-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 115685335 |
| Molecular Formula | C10H14N2S2 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)pyridin-2-amine |
| SMILES | c1ccc(NCC2CSCCS2)nc1 |
| InChI | InChI=1S/C10H14N2S2/c1-2-4-11-10(3-1)12-7-9-8-13-5-6-14-9/h1-4,9H,5-8H2,(H,11,12) |
| InChIKey | DPSDHWPZLCUTCA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |