C10H15N3OS2 — CID 115689528
N-(1,4-dithian-2-ylmethyl)-4-methoxypyrimidin-2-amine (PubChem CID 115689528) has the molecular formula C10H15N3OS2 and a molecular weight of 257.38 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-4-methoxypyrimidin-2-amine.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-4-methoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 115689528 |
| Molecular Formula | C10H15N3OS2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-4-methoxypyrimidin-2-amine |
| SMILES | COc1ccnc(NCC2CSCCS2)n1 |
| InChI | InChI=1S/C10H15N3OS2/c1-14-9-2-3-11-10(13-9)12-6-8-7-15-4-5-16-8/h2-3,8H,4-7H2,1H3,(H,11,12,13) |
| InChIKey | PSZUZTHGCSBTIJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |