C13H21N3OS — CID 112638269
4-propoxy-N-(thian-2-ylmethyl)pyrimidin-2-amine (PubChem CID 112638269) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is 4-propoxy-N-(thian-2-ylmethyl)pyrimidin-2-amine.
| Compound Name | 4-propoxy-N-(thian-2-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112638269 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 4-propoxy-N-(thian-2-ylmethyl)pyrimidin-2-amine |
| SMILES | CCCOc1ccnc(NCC2CCCCS2)n1 |
| InChI | InChI=1S/C13H21N3OS/c1-2-8-17-12-6-7-14-13(16-12)15-10-11-5-3-4-9-18-11/h6-7,11H,2-5,8-10H2,1H3,(H,14,15,16) |
| InChIKey | YZNOKDIZUPDKSL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |