C11H17N3O — CID 112684482
N-(cyclopentylmethyl)-4-methoxypyrimidin-2-amine (PubChem CID 112684482) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-4-methoxypyrimidin-2-amine.
| Compound Name | N-(cyclopentylmethyl)-4-methoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 112684482 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | N-(cyclopentylmethyl)-4-methoxypyrimidin-2-amine |
| SMILES | COc1ccnc(NCC2CCCC2)n1 |
| InChI | InChI=1S/C11H17N3O/c1-15-10-6-7-12-11(14-10)13-8-9-4-2-3-5-9/h6-7,9H,2-5,8H2,1H3,(H,12,13,14) |
| InChIKey | SKPTWWNLAMJLGZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |