C9H14N4S2 — CID 116797435
2-N-(1,4-dithian-2-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 116797435) has the molecular formula C9H14N4S2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2-N-(1,4-dithian-2-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(1,4-dithian-2-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 116797435 |
| Molecular Formula | C9H14N4S2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2-N-(1,4-dithian-2-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ccnc(NCC2CSCCS2)n1 |
| InChI | InChI=1S/C9H14N4S2/c10-8-1-2-11-9(13-8)12-5-7-6-14-3-4-15-7/h1-2,7H,3-6H2,(H3,10,11,12,13) |
| InChIKey | VUGANPCTXJJJDG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |